Products 2098903-52-5
CAS 2098903-52-5 is the registry number for 2-Bromo-5-trifluoromethoxyphenylacetamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-[2-bromo-5-(trifluoromethoxy)phenyl]acetamide (CAS 2098903-52-5) is a chemical compound with the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. IUPAC name: 2-[2-bromo-5-(trifluoromethoxy)phenyl]acetamide. InChIKey: USPCMXHYXBHPFU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO2 |
|---|---|
| Molecular weight | 298.06 g/mol |
| IUPAC name | 2-[2-bromo-5-(trifluoromethoxy)phenyl]acetamide |
| InChIKey | USPCMXHYXBHPFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CC(=O)N)Br |
Computed by PubChem (NCBI)