Products 2101658-60-8
CAS 2101658-60-8 appears in our catalog under these names: 8–methyl–7–(trifluoromethyl)quinolin–2(1H)–one, 8-methyl-7-(trifluoromethyl)quinolin-2(1H)-one, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
8-methyl-7-(trifluoromethyl)-1H-quinolin-2-one (CAS 2101658-60-8) is a chemical compound with the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. IUPAC name: 8-methyl-7-(trifluoromethyl)-1H-quinolin-2-one. InChIKey: TXJKOSUMIVZQTO-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO |
|---|---|
| Molecular weight | 227.18 g/mol |
| IUPAC name | 8-methyl-7-(trifluoromethyl)-1H-quinolin-2-one |
| InChIKey | TXJKOSUMIVZQTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C=C2)C(F)(F)F |
Computed by PubChem (NCBI)