Products 210231-09-7
CAS 210231-09-7 is the registry number for Pterophyllin 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-methyl-2-prop-1-en-2-ylfuro[3,2-c]chromen-4-one (CAS 210231-09-7) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 9-methyl-2-prop-1-en-2-ylfuro[3,2-c]chromen-4-one. InChIKey: VQUALAOMJNCAIH-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 9-methyl-2-prop-1-en-2-ylfuro[3,2-c]chromen-4-one |
| InChIKey | VQUALAOMJNCAIH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)OC(=O)C3=C2OC(=C3)C(=C)C |
Computed by PubChem (NCBI)