CAS 2102999-49-3 is the registry number for (4R)-4-{((tert-Butoxy)carbonyl)amino}-3-hydroxypentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2102999-49-3) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: (4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: LODRCJFHZBNAHN-ULUSZKPHSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | LODRCJFHZBNAHN-ULUSZKPHSA-N |
| SMILES | C[C@H](C(CC(=O)O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)