Products 2105575-06-0
CAS 2105575-06-0 is the registry number for Etomidate Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-phenylethyl)-2-sulfanylidene-1H-imidazole-4-carboxylic acid (CAS 2105575-06-0) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 3-(1-phenylethyl)-2-sulfanylidene-1H-imidazole-4-carboxylic acid. InChIKey: KCWRAMZXSYCRAC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 3-(1-phenylethyl)-2-sulfanylidene-1H-imidazole-4-carboxylic acid |
| InChIKey | KCWRAMZXSYCRAC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C(=CNC2=S)C(=O)O |
Computed by PubChem (NCBI)