CAS 210569-69-0 appears in our catalog under these names: 3–(6–bromo–1H–indol–3–yl)propanoic Acid, 3-(6-Bromo-1H-indol-3-yl)propanoic acid, ≥95%, ≥95%, 3-(6-BROMO-3-INDOLYL)PROPANOIC ACID, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(6-bromo-1H-indol-3-yl)propanoic acid (CAS 210569-69-0) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 3-(6-bromo-1H-indol-3-yl)propanoic acid. InChIKey: RLHSUKOLQNHGRC-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 3-(6-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | RLHSUKOLQNHGRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2CCC(=O)O |
Computed by PubChem (NCBI)