CAS 2106388-24-1 is the registry number for Ethyl 2-oxo-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carboxylate (CAS 2106388-24-1) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: ethyl 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carboxylate. InChIKey: AEAFBCRUIBVXDX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | ethyl 2-oxo-1,3-dihydropyrrolo[3,2-b]pyridine-5-carboxylate |
| InChIKey | AEAFBCRUIBVXDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C1)NC(=O)C2 |
Computed by PubChem (NCBI)