CAS 2106483-62-7 is the registry number for 5-Chloro-6-methoxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-6-methoxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 2106483-62-7) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 5-chloro-6-methoxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: AEWQXXFECZWIGX-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 5-chloro-6-methoxy-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | AEWQXXFECZWIGX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NCCC2C(=O)O)Cl |
Computed by PubChem (NCBI)