CAS 210834-98-3 appears in our catalog under these names: 4-Chloro-6-fluoro-1,3-benzothiazol-2-amine, 95%, 4-Chloro-6-fluorobenzo(d)thiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-chloro-6-fluoro-1,3-benzothiazol-2-amine (CAS 210834-98-3) is a chemical compound with the molecular formula C7H4ClFN2S and a molecular weight of 202.64 g/mol. IUPAC name: 4-chloro-6-fluoro-1,3-benzothiazol-2-amine. InChIKey: TYFVRZURNJXRTK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2S |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 4-chloro-6-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | TYFVRZURNJXRTK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)N)Cl)F |
Computed by PubChem (NCBI)