CAS 942473-92-9 is the registry number for 5-Chloro-4-fluoro-1,3-benzothiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-4-fluoro-1,3-benzothiazol-2-amine (CAS 942473-92-9) is a chemical compound with the molecular formula C7H4ClFN2S and a molecular weight of 202.64 g/mol. IUPAC name: 5-chloro-4-fluoro-1,3-benzothiazol-2-amine. InChIKey: RWUOSOHBOYWICN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2S |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 5-chloro-4-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | RWUOSOHBOYWICN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1SC(=N2)N)F)Cl |
Computed by PubChem (NCBI)