CAS 329926-78-5 is the registry number for 3-Chloro-2-fluoro-4-thiocyanatoaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(4-amino-2-chloro-3-fluorophenyl) thiocyanate (CAS 329926-78-5) is a chemical compound with the molecular formula C7H4ClFN2S and a molecular weight of 202.64 g/mol. IUPAC name: (4-amino-2-chloro-3-fluorophenyl) thiocyanate. InChIKey: RCUGVUCRZOXCHL-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2S |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (4-amino-2-chloro-3-fluorophenyl) thiocyanate |
| InChIKey | RCUGVUCRZOXCHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)F)Cl)SC#N |
Computed by PubChem (NCBI)