CAS 634909-27-6 appears in our catalog under these names: 6-Chloro-5-fluorobenzo[d]thiazol-2-amine 95%, 6-Chloro-5-fluorobenzo[d]thiazol-2-amine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-chloro-5-fluoro-1,3-benzothiazol-2-amine (CAS 634909-27-6) is a chemical compound with the molecular formula C7H4ClFN2S and a molecular weight of 202.64 g/mol. IUPAC name: 6-chloro-5-fluoro-1,3-benzothiazol-2-amine. InChIKey: OKTZUXGSXXPGMT-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2S |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 6-chloro-5-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | OKTZUXGSXXPGMT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Cl)SC(=N2)N |
Computed by PubChem (NCBI)