CAS 942473-93-0 is the registry number for 6-Chloro-4-fluoro-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 10g.
6-chloro-4-fluoro-1,3-benzothiazol-2-amine (CAS 942473-93-0) is a chemical compound with the molecular formula C7H4ClFN2S and a molecular weight of 202.64 g/mol. IUPAC name: 6-chloro-4-fluoro-1,3-benzothiazol-2-amine. InChIKey: AHFUZIIJDNCFRZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClFN2S |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 6-chloro-4-fluoro-1,3-benzothiazol-2-amine |
| InChIKey | AHFUZIIJDNCFRZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1F)N=C(S2)N)Cl |
Computed by PubChem (NCBI)