CAS 2113-68-0 appears in our catalog under these names: [1,1'-Biphenyl]-4-sulfonic acid, 98%, 98%, 4-Biphenylsulfonic Acid, 98%, [1,1'-Biphenyl]-4-sulfonic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
4-phenylbenzenesulfonic acid (CAS 2113-68-0) is a chemical compound with the molecular formula C12H10O3S and a molecular weight of 234.27 g/mol. IUPAC name: 4-phenylbenzenesulfonic acid. InChIKey: XDTYUYVIGLIFCW-UHFFFAOYSA-N.
| Molecular formula | C12H10O3S |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 4-phenylbenzenesulfonic acid |
| InChIKey | XDTYUYVIGLIFCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)