Products 21136-70-9
CAS 21136-70-9 is the registry number for Benzidine sulfate. Offered by: Biosynth. Available pack sizes: 100g, 50g.
4-(4-aminophenyl)aniline;sulfuric acid (CAS 21136-70-9) is a chemical compound with the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. IUPAC name: 4-(4-aminophenyl)aniline;sulfuric acid. InChIKey: ZOXJIQNURSAHRV-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O4S |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 4-(4-aminophenyl)aniline;sulfuric acid |
| InChIKey | ZOXJIQNURSAHRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)