Products 21139-30-0
CAS 21139-30-0 is the registry number for 5-Chloro-3-phenyl-1H-indole-2-carboxamide, 90%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
5-chloro-3-phenyl-1H-indole-2-carboxamide (CAS 21139-30-0) is a chemical compound with the molecular formula C15H11ClN2O and a molecular weight of 270.71 g/mol. IUPAC name: 5-chloro-3-phenyl-1H-indole-2-carboxamide. InChIKey: ASGAHGHLFFGPBN-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1H-indole-2-carboxamide |
| InChIKey | ASGAHGHLFFGPBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC3=C2C=C(C=C3)Cl)C(=O)N |
Computed by PubChem (NCBI)