Products 21139-31-1
CAS 21139-31-1 appears in our catalog under these names: 5-Chloro-3-phenyl-1h-indole-2-carboxylic acid, 95%, 5-Chloro-3-phenyl-1H-indole-2-carboxylic acid, 95+%, 5–Chloro–3–phenyl–1H–indole–2–carboxylic acid, 5-Chloro-3-phenyl-1H-indole-2-carboxylic acid, ≥98%, ≥98%, 5-Chloro-3-phenyl-1H-indole-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g.
5-chloro-3-phenyl-1H-indole-2-carboxylic acid (CAS 21139-31-1) is a chemical compound with the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. IUPAC name: 5-chloro-3-phenyl-1H-indole-2-carboxylic acid. InChIKey: WQRNPWUZAVBEBC-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1H-indole-2-carboxylic acid |
| InChIKey | WQRNPWUZAVBEBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(NC3=C2C=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)