CAS 61112-01-4 is the registry number for Bromfenac Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
7-(4-chlorobenzoyl)-1,3-dihydroindol-2-one (CAS 61112-01-4) is a chemical compound with the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. IUPAC name: 7-(4-chlorobenzoyl)-1,3-dihydroindol-2-one. InChIKey: UVSBYFSXFHZBHB-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 7-(4-chlorobenzoyl)-1,3-dihydroindol-2-one |
| InChIKey | UVSBYFSXFHZBHB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)C3=CC=C(C=C3)Cl)NC1=O |
Computed by PubChem (NCBI)