CAS 26960-68-9 appears in our catalog under these names: 1-Benzyl-5-chloro-2,3-dihydro-1h-indole-2,3-dione, 98%, 1-Benzyl-5-chloro-2,3-dihydro-1H-indole-2,3-dione, 95%, 1-Benzyl-5-chloroindoline-2,3-dione, >95.0%(T)(qNMR), 1-Benzyl-5-chloro-2,3-dihydro-1H-indole-2,3-dione. Offered by: Combi-blocks, AmBeed, TCI, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-benzyl-5-chloroindole-2,3-dione (CAS 26960-68-9) is a chemical compound with the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. IUPAC name: 1-benzyl-5-chloroindole-2,3-dione. InChIKey: CCPOUFJZMAONLI-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 1-benzyl-5-chloroindole-2,3-dione |
| InChIKey | CCPOUFJZMAONLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)C(=O)C2=O |
Computed by PubChem (NCBI)