CAS 306279-75-4 is the registry number for 1-(2-Chlorobenzyl)-1h-indole-2,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-[(2-chlorophenyl)methyl]indole-2,3-dione (CAS 306279-75-4) is a chemical compound with the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]indole-2,3-dione. InChIKey: GXOAQYBGXKBALO-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]indole-2,3-dione |
| InChIKey | GXOAQYBGXKBALO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C3=CC=CC=C3C(=O)C2=O)Cl |
Computed by PubChem (NCBI)