CAS 28563-19-1 appears in our catalog under these names: 7-Chloro-4-hydroxy-3-phenyl-2(1h)-quinolinone, 95%, 2(1H)-Quinolinone, 7-chloro-4-hydroxy-3-phenyl-, 98%, 7–chloro–2–hydroxy–3–phenylquinolin–4(1H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
7-chloro-4-hydroxy-3-phenyl-1H-quinolin-2-one (CAS 28563-19-1) is a chemical compound with the molecular formula C15H10ClNO2 and a molecular weight of 271.70 g/mol. IUPAC name: 7-chloro-4-hydroxy-3-phenyl-1H-quinolin-2-one. InChIKey: RDXQSWLUXKUQSI-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO2 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 7-chloro-4-hydroxy-3-phenyl-1H-quinolin-2-one |
| InChIKey | RDXQSWLUXKUQSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=C(C=C(C=C3)Cl)NC2=O)O |
Computed by PubChem (NCBI)