CAS 2114046-05-6 is the registry number for 3,7,8-Trimethylisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,7,8-trimethylisoquinoline (CAS 2114046-05-6) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 3,7,8-trimethylisoquinoline. InChIKey: UZEFQPZFOPMNMQ-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 3,7,8-trimethylisoquinoline |
| InChIKey | UZEFQPZFOPMNMQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=C(N=C2)C)C |
Computed by PubChem (NCBI)