CAS 211637-74-0 appears in our catalog under these names: Fmoc–Phe(3–Me)–OH, Fmoc-Phe(3-Me)-OH 97%, Fmoc-3-methyl-L-phenylalanine, 96%, 96%, Fmoc-Phe(3-Me)-OH, 99.60%, FMOC-3-METHYL-L-PHENYLALANINE, 96%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 10g, 1g, 25g, 5g, 250mg, 100mg, 5 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylphenyl)propanoic acid (CAS 211637-74-0) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylphenyl)propanoic acid. InChIKey: NJXPSSISZLAXRE-QHCPKHFHSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylphenyl)propanoic acid |
| InChIKey | NJXPSSISZLAXRE-QHCPKHFHSA-N |
| SMILES | CC1=CC(=CC=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)