Products 2118244-83-8
CAS 2118244-83-8 appears in our catalog under these names: Pyrimethanil D5 (phenyl D5), Pyrimethanil-d5 (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Pyrimethanil-d5 (phenyl-d5), >95% (HPLC), Pyrimethanil-d5, >95% (HPLC), Pyrimethanil–d5. Offered by: Dr. Ehrenstorfer, CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 0,01g, 0,005g, 5mg, 100mg, 1mg, 1 mg, 1x1ml.
4,6-dimethyl-N-(2,3,4,5,6-pentadeuteriophenyl)pyrimidin-2-amine (CAS 2118244-83-8) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 204.28 g/mol. IUPAC name: 4,6-dimethyl-N-(2,3,4,5,6-pentadeuteriophenyl)pyrimidin-2-amine. InChIKey: ZLIBICFPKPWGIZ-DKFMXDSJSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 204.28 g/mol |
| IUPAC name | 4,6-dimethyl-N-(2,3,4,5,6-pentadeuteriophenyl)pyrimidin-2-amine |
| InChIKey | ZLIBICFPKPWGIZ-DKFMXDSJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC2=NC(=CC(=N2)C)C)[2H])[2H] |
Computed by PubChem (NCBI)