CAS 1247384-22-0 is the registry number for 4-(3,4-Dimethylphenyl)pyrimidin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(3,4-dimethylphenyl)pyrimidin-2-amine (CAS 1247384-22-0) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)pyrimidin-2-amine. InChIKey: LWBORFHJCDTQEO-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)pyrimidin-2-amine |
| InChIKey | LWBORFHJCDTQEO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC(=NC=C2)N)C |
Computed by PubChem (NCBI)