CAS 79707-12-3 appears in our catalog under these names: N3-Benzylpyridine-2,3-diamine, 95%, N3-Benzylpyridine-2,3-diamine 95+%, N3-Benzylpyridine-2,3-diamine, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-N-benzylpyridine-2,3-diamine (CAS 79707-12-3) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-N-benzylpyridine-2,3-diamine. InChIKey: MUKAGFLFIMVSQN-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-N-benzylpyridine-2,3-diamine |
| InChIKey | MUKAGFLFIMVSQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(N=CC=C2)N |
Computed by PubChem (NCBI)