CAS 89399-92-8 is the registry number for 2-Phenyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine (CAS 89399-92-8) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine. InChIKey: VUBNLJXWVXGFSH-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-amine |
| InChIKey | VUBNLJXWVXGFSH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(N(N=C2C1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)