CAS 1368465-84-2 is the registry number for 1-Isopropyl-2-methyl-1,3-benzodiazole-5-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-methyl-1-propan-2-ylbenzimidazole-5-carbonitrile (CAS 1368465-84-2) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 2-methyl-1-propan-2-ylbenzimidazole-5-carbonitrile. InChIKey: BOHCWBBJHYXQJQ-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-methyl-1-propan-2-ylbenzimidazole-5-carbonitrile |
| InChIKey | BOHCWBBJHYXQJQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)C=CC(=C2)C#N |
Computed by PubChem (NCBI)