CAS 211933-66-3 is the registry number for (3-Bromophenoxy)acetyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-bromophenoxy)acetyl chloride (CAS 211933-66-3) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(3-bromophenoxy)acetyl chloride. InChIKey: QDNSCGJICMXLIZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-(3-bromophenoxy)acetyl chloride |
| InChIKey | QDNSCGJICMXLIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OCC(=O)Cl |
Computed by PubChem (NCBI)