Products 2120264-10-8
CAS 2120264-10-8 is the registry number for Methyl 3-chloropyrazolo[1,5-a]pyrimidine-6-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-chloropyrazolo[1,5-a]pyrimidine-6-carboxylate (CAS 2120264-10-8) is a chemical compound with the molecular formula C8H6ClN3O2 and a molecular weight of 211.60 g/mol. IUPAC name: methyl 3-chloropyrazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: QXUKIZZIDIXSEL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O2 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | methyl 3-chloropyrazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | QXUKIZZIDIXSEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=C(C=N2)Cl)N=C1 |
Computed by PubChem (NCBI)