CAS 2120575-78-0 is the registry number for Ethyl 2-isopropyl-1-oxo-1,2-dihydroisoquinoline-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 1-oxo-2-propan-2-ylisoquinoline-7-carboxylate (CAS 2120575-78-0) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: ethyl 1-oxo-2-propan-2-ylisoquinoline-7-carboxylate. InChIKey: ONICSOLQDXCMNE-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | ethyl 1-oxo-2-propan-2-ylisoquinoline-7-carboxylate |
| InChIKey | ONICSOLQDXCMNE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=CN(C2=O)C(C)C |
Computed by PubChem (NCBI)