CAS 27820-98-0 is the registry number for 1,2:3,4-Di-O-isopropylidene-b-L-arabinopyranose. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (CAS 27820-98-0) is a chemical compound with the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. IUPAC name: (1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane. InChIKey: PITVFGWVJISGEN-RBXMUDONSA-N.
| Molecular formula | C11H18O5 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| InChIKey | PITVFGWVJISGEN-RBXMUDONSA-N |
| SMILES | CC1(O[C@H]2CO[C@H]3[C@@H]([C@H]2O1)OC(O3)(C)C)C |
Computed by PubChem (NCBI)