CAS 2121512-60-3 appears in our catalog under these names: 2,5-Difluoro-4-isopropoxybenzaldehyde, 95%, 2,5-Difluoro-4-isopropoxybenzaldehyde, ≥95%, ≥95%, 2,5-Difluoro-4-isopropoxybenzaldehyde, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2,5-difluoro-4-propan-2-yloxybenzaldehyde (CAS 2121512-60-3) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2,5-difluoro-4-propan-2-yloxybenzaldehyde. InChIKey: VLSGYUVERWPKBR-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2,5-difluoro-4-propan-2-yloxybenzaldehyde |
| InChIKey | VLSGYUVERWPKBR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C(=C1)F)C=O)F |
Computed by PubChem (NCBI)