Products 2121514-54-1
CAS 2121514-54-1 appears in our catalog under these names: 4,5-Dimethyl-2-ethoxyphenylboronic acid, 95%, 4,5-Dimethyl-2-ethoxyphenylboronic acid, ≥95%, ≥95%, 4,5-Dimethyl-2-ethoxyphenylboronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
(2-ethoxy-4,5-dimethylphenyl)boronic acid (CAS 2121514-54-1) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (2-ethoxy-4,5-dimethylphenyl)boronic acid. InChIKey: IXYAHKGBSDTZAQ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (2-ethoxy-4,5-dimethylphenyl)boronic acid |
| InChIKey | IXYAHKGBSDTZAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC)C)C)(O)O |
Computed by PubChem (NCBI)