CAS 212204-36-9 appears in our catalog under these names: Benzyl (S)-2-((chlorosulfonyl)methyl)pyrrolidine-1-carboxylate, 98%, (S)-2-Chlorosulfonylmethyl-pyrrolidine-1-carboxylic acid benzyl ester. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Benzyl (2S)-2-(chlorosulfonylmethyl)pyrrolidine-1-carboxylate (CAS 212204-36-9) is a chemical compound with the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. IUPAC name: benzyl (2S)-2-(chlorosulfonylmethyl)pyrrolidine-1-carboxylate. InChIKey: WFSXSKWRWQOOAY-LBPRGKRZSA-N.
| Molecular formula | C13H16ClNO4S |
|---|---|
| Molecular weight | 317.79 g/mol |
| IUPAC name | benzyl (2S)-2-(chlorosulfonylmethyl)pyrrolidine-1-carboxylate |
| InChIKey | WFSXSKWRWQOOAY-LBPRGKRZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)