Products 21231-65-2
CAS 21231-65-2 is the registry number for 5-(3,4-Dimethoxybenzyl)-5-ethyl-hydantoin. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-[(3,4-dimethoxyphenyl)methyl]-5-ethylimidazolidine-2,4-dione (CAS 21231-65-2) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 5-[(3,4-dimethoxyphenyl)methyl]-5-ethylimidazolidine-2,4-dione. InChIKey: ANZZETGCYJWZNV-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 5-[(3,4-dimethoxyphenyl)methyl]-5-ethylimidazolidine-2,4-dione |
| InChIKey | ANZZETGCYJWZNV-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)NC(=O)N1)CC2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)