Products 2124754-01-2
CAS 2124754-01-2 is the registry number for 2,3-Dihydrospiro(indene-1,2'-morpholine)-4'-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Spiro[1,2-dihydroindene-3,2'-morpholine]-4'-carboxamide (CAS 2124754-01-2) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: spiro[1,2-dihydroindene-3,2'-morpholine]-4'-carboxamide. InChIKey: CFPFEAUFXKXEIQ-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | spiro[1,2-dihydroindene-3,2'-morpholine]-4'-carboxamide |
| InChIKey | CFPFEAUFXKXEIQ-UHFFFAOYSA-N |
| SMILES | C1CC2(CN(CCO2)C(=O)N)C3=CC=CC=C31 |
Computed by PubChem (NCBI)