CAS 2126160-09-4 is the registry number for 3–{((tert–Butoxy)carbonyl)amino}–1–(diphenylmethyl)azetidine–3–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-benzhydryl-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-3-carboxylic acid (CAS 2126160-09-4) is a chemical compound with the molecular formula C22H26N2O4 and a molecular weight of 382.5 g/mol. IUPAC name: 1-benzhydryl-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-3-carboxylic acid. InChIKey: KUDCROGWRHZKDZ-UHFFFAOYSA-N.
| Molecular formula | C22H26N2O4 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 1-benzhydryl-3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-3-carboxylic acid |
| InChIKey | KUDCROGWRHZKDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)