CAS 21296-93-5 appears in our catalog under these names: 5–Chloro–2,3–dimethyl–1H–indole, 5-Chloro-2,3-dimethyl-1H-indole 95%, 5-Chloro-2,3-dimethyl-1H-indole, 95%, 5-Chloro-2,3-dimethyl-1H-indole, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
5-chloro-2,3-dimethyl-1H-indole (CAS 21296-93-5) is a chemical compound with the molecular formula C10H10ClN and a molecular weight of 179.64 g/mol. IUPAC name: 5-chloro-2,3-dimethyl-1H-indole. InChIKey: UGVBTQYPCQFAER-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 5-chloro-2,3-dimethyl-1H-indole |
| InChIKey | UGVBTQYPCQFAER-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)