Products 21296-94-6
CAS 21296-94-6 appears in our catalog under these names: 2,3-Dimethyl-5-nitroindole, 95%, 2,3–Dimethyl–5–nitroindole, 2,3-Dimethyl-5-nitro-1H-indole 97%, 2,3-Dimethyl-5-nitro-1H-indole, 97%, 97%, 2,3-Dimethyl-5-nitroindole, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
2,3-dimethyl-5-nitro-1H-indole (CAS 21296-94-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2,3-dimethyl-5-nitro-1H-indole. InChIKey: LKIMRQIKTONPER-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2,3-dimethyl-5-nitro-1H-indole |
| InChIKey | LKIMRQIKTONPER-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)