CAS 21298-80-6 appears in our catalog under these names: (2-Oxo-1,2-dihydro-quinolin-4-yl)-acetic acid, 95%, 2-(2-Oxo-1,2-dihydroquinolin-4-yl)acetic acid, 97%, (2-Oxo-1,2-dihydro-quinolin-4-yl)-acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 0,5g, 50mg.
2-(2-oxo-1H-quinolin-4-yl)acetic acid (CAS 21298-80-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 2-(2-oxo-1H-quinolin-4-yl)acetic acid. InChIKey: UXVHMJOEWPQFFT-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 2-(2-oxo-1H-quinolin-4-yl)acetic acid |
| InChIKey | UXVHMJOEWPQFFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)