Products 21320-90-1
CAS 21320-90-1 appears in our catalog under these names: 2–Methyl–4–nitrobenzene–1–sulfonyl chloride, 5-NITROTOLUENE-2-SULPHONYL CHLORIDE, 95%, 2-Methyl-4-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-methyl-4-nitrobenzenesulfonyl chloride (CAS 21320-90-1) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 2-methyl-4-nitrobenzenesulfonyl chloride. InChIKey: WREICNIHNBOUJV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 2-methyl-4-nitrobenzenesulfonyl chloride |
| InChIKey | WREICNIHNBOUJV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-methyl-4-nitrobenzenesulfonyl chloride, 5-Nitrotoluene-2-sulphonyl chloride, Benzenesulfonyl chloride, 2-methyl-4-nitro-, 2-methyl-4-nitrobenzene-1-sulfonyl chloride, 2-methyl-4-nitro-benzenesulfonyl chloride, 2-methyl-4-nitrobenzene-1-sulfonylchloride, 2-methyl-4-nitrobenzene-sulfonic acid chloride