CAS 213382-05-9 is the registry number for 2,3-Dichloropropiophenone. Offered by: TRC. Available pack sizes: 1g.
1-(2,3-dichlorophenyl)propan-1-one (CAS 213382-05-9) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)propan-1-one. InChIKey: RMIJMXPBQBQCHQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)propan-1-one |
| InChIKey | RMIJMXPBQBQCHQ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)