Products 2137143-61-2
CAS 2137143-61-2 is the registry number for (1R)-2-Amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol;hydrochloride (CAS 2137143-61-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (1R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol;hydrochloride. InChIKey: OZGINOLIBBNPTA-QRPNPIFTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | (1R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanol;hydrochloride |
| InChIKey | OZGINOLIBBNPTA-QRPNPIFTSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)[C@H](CN)O.Cl |
Computed by PubChem (NCBI)