CAS 2137432-91-6 appears in our catalog under these names: Rel-(3aR,6aR)-hexahydro-2H-furo(3,2-b)pyrrole-5-carboxylic acid hydrochloride, 98%, rac-(3aR,6aR)-Hexahydro-2H-furo(3,2-b)pyrrole-5-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxylic acid;hydrochloride (CAS 2137432-91-6) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: (3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxylic acid;hydrochloride. InChIKey: TTWWPEFTTXFCCU-PATRPMPQSA-N.
| Molecular formula | C7H12ClNO3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | (3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole-5-carboxylic acid;hydrochloride |
| InChIKey | TTWWPEFTTXFCCU-PATRPMPQSA-N |
| SMILES | C1CO[C@H]2[C@@H]1NC(C2)C(=O)O.Cl |
Computed by PubChem (NCBI)