CAS 2137631-73-1 is the registry number for rac-2-((1R,3S)-3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)cyclopentyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(1R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetic acid (CAS 2137631-73-1) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 2-[(1R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetic acid. InChIKey: HTDIEBAPWFRHFZ-CABCVRRESA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-[(1R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentyl]acetic acid |
| InChIKey | HTDIEBAPWFRHFZ-CABCVRRESA-N |
| SMILES | C1C[C@@H](C[C@@H]1CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)