Products 2137759-45-4
CAS 2137759-45-4 appears in our catalog under these names: 5-Bromo-2,7-dimethyl[1,2,4]triazolo[1,5-a]pyridine, 95%, 5-bromo-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-bromo-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine (CAS 2137759-45-4) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 5-bromo-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: DVDTVXCJRUHLPY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 5-bromo-2,7-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | DVDTVXCJRUHLPY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=NN2C(=C1)Br)C |
Computed by PubChem (NCBI)