Products 2137787-30-3

CAS 2137787-30-3 is the registry number for 2-Methyl-2-(4-(pyridin-4-yl)-1H-1,2,3-triazol-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methyl-2-(4-pyridin-4-yltriazol-1-yl)propanoic acid (CAS 2137787-30-3) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: 2-methyl-2-(4-pyridin-4-yltriazol-1-yl)propanoic acid. InChIKey: PVQLLFSVYOAUSV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N4O2
Molecular weight232.24 g/mol
IUPAC name2-methyl-2-(4-pyridin-4-yltriazol-1-yl)propanoic acid
InChIKeyPVQLLFSVYOAUSV-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)N1C=C(N=N1)C2=CC=NC=C2

Computed by PubChem (NCBI)