Products 2137827-99-5
CAS 2137827-99-5 is the registry number for Methyl 7-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 7-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS 2137827-99-5) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: methyl 7-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate. InChIKey: WLVRLRSKYSPFTD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | methyl 7-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
| InChIKey | WLVRLRSKYSPFTD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CN=CC(=C2N1)Cl |
Computed by PubChem (NCBI)