CAS 2138005-71-5 is the registry number for 5-Amino-1-((3-chlorophenyl)methyl)-1,2-dihydropyridin-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-amino-1-[(3-chlorophenyl)methyl]pyridin-2-one;hydrochloride (CAS 2138005-71-5) is a chemical compound with the molecular formula C12H12Cl2N2O and a molecular weight of 271.14 g/mol. IUPAC name: 5-amino-1-[(3-chlorophenyl)methyl]pyridin-2-one;hydrochloride. InChIKey: PHQUVFCRPFHNPG-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 5-amino-1-[(3-chlorophenyl)methyl]pyridin-2-one;hydrochloride |
| InChIKey | PHQUVFCRPFHNPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CN2C=C(C=CC2=O)N.Cl |
Computed by PubChem (NCBI)